About ruthenium(2+);nitrate;nitrite
ruthenium(2+);nitrate;nitrite (PubChem CID 175288692) has the molecular formula N2O5Ru
and a molecular weight of 209.08 g/mol. Its IUPAC name is ruthenium(2+);nitrate;nitrite.
Molecular Properties
| Compound Name | ruthenium(2+);nitrate;nitrite |
| PubChem CID | 175288692 |
| Molecular Formula | N2O5Ru |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 209.89 |
| IUPAC Name | ruthenium(2+);nitrate;nitrite |
| SMILES | O=N[O-].O=[N+]([O-])[O-].[Ru+2] |
| InChI | InChI=1S/NO3.HNO2.Ru/c2-1(3)4;2-1-3;/h;(H,2,3);/q-1;;+2/p-1 |
| InChIKey | LDOSPGZDZCPRLA-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 118.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ruthenium(2+);nitrate;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium(2+);nitrate;nitrite?
The IUPAC name of ruthenium(2+);nitrate;nitrite (CID 175288692) is ruthenium(2+);nitrate;nitrite.
What is the SMILES notation for ruthenium(2+);nitrate;nitrite?
The canonical SMILES for ruthenium(2+);nitrate;nitrite is O=N[O-].O=[N+]([O-])[O-].[Ru+2].
What is the InChIKey of ruthenium(2+);nitrate;nitrite?
The InChIKey is LDOSPGZDZCPRLA-UHFFFAOYSA-M. The full InChI is InChI=1S/NO3.HNO2.Ru/c2-1(3)4;2-1-3;/h;(H,2,3);/q-1;;+2/p-1.
What are the key properties of ruthenium(2+);nitrate;nitrite?
ruthenium(2+);nitrate;nitrite has a molecular weight of 209.08 g/mol, XLogP of 0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium(2+);nitrate;nitrite is sourced from PubChem (CID 175288692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).