About azanium;nitric acid;nitrite
azanium;nitric acid;nitrite (PubChem CID 22114427) has the molecular formula H5N3O5
and a molecular weight of 127.06 g/mol. Its IUPAC name is azanium;nitric acid;nitrite.
Molecular Properties
| Compound Name | azanium;nitric acid;nitrite |
| PubChem CID | 22114427 |
| Molecular Formula | H5N3O5 |
| Molecular Weight | 127.06 g/mol |
| Exact Mass | 127.02 |
| IUPAC Name | azanium;nitric acid;nitrite |
| SMILES | O=N[O-].O=[N+]([O-])O.[NH4+] |
| InChI | InChI=1S/HNO3.HNO2.H3N/c2-1(3)4;2-1-3;/h(H,2,3,4);(H,2,3);1H3 |
| InChIKey | AUJWFEDOKMPQCR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.06 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanium;nitric acid;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;nitric acid;nitrite?
The IUPAC name of azanium;nitric acid;nitrite (CID 22114427) is azanium;nitric acid;nitrite.
What is the SMILES notation for azanium;nitric acid;nitrite?
The canonical SMILES for azanium;nitric acid;nitrite is O=N[O-].O=[N+]([O-])O.[NH4+].
What is the InChIKey of azanium;nitric acid;nitrite?
The InChIKey is AUJWFEDOKMPQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/HNO3.HNO2.H3N/c2-1(3)4;2-1-3;/h(H,2,3,4);(H,2,3);1H3.
What are the key properties of azanium;nitric acid;nitrite?
azanium;nitric acid;nitrite has a molecular weight of 127.06 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;nitric acid;nitrite is sourced from PubChem (CID 22114427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).