C17H26INO4 — CID 175293275
[2-ethyl-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]carbamic acid (PubChem CID 175293275) has the molecular formula C17H26INO4 and a molecular weight of 435.30 g/mol. Its IUPAC name is [2-ethyl-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]carbamic acid.
| Compound Name | [2-ethyl-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]carbamic acid |
|---|---|
| PubChem CID | 175293275 |
| Molecular Formula | C17H26INO4 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [2-ethyl-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]carbamic acid |
| SMILES | CCCCC(CC)C(NC(=O)O)(OCOC)c1ccccc1I |
| InChI | InChI=1S/C17H26INO4/c1-4-6-9-13(5-2)17(19-16(20)21,23-12-22-3)14-10-7-8-11-15(14)18/h7-8,10-11,13,19H,4-6,9,12H2,1-3H3,(H,20,21) |
| InChIKey | LZLOEZYMDOQALI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|