C14H20INO3 — CID 140610619
[(1S)-1-hydroxy-1-(2-iodophenyl)butyl] N-propan-2-ylcarbamate (PubChem CID 140610619) has the molecular formula C14H20INO3 and a molecular weight of 377.22 g/mol. Its IUPAC name is [(1S)-1-hydroxy-1-(2-iodophenyl)butyl] N-propan-2-ylcarbamate.
| Compound Name | [(1S)-1-hydroxy-1-(2-iodophenyl)butyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 140610619 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [(1S)-1-hydroxy-1-(2-iodophenyl)butyl] N-propan-2-ylcarbamate |
| SMILES | CCC[C@](O)(OC(=O)NC(C)C)c1ccccc1I |
| InChI | InChI=1S/C14H20INO3/c1-4-9-14(18,19-13(17)16-10(2)3)11-7-5-6-8-12(11)15/h5-8,10,18H,4,9H2,1-3H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | OHTWCSDTNSPXJV-AWEZNQCLSA-N |
| XLogP | 3.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|