C15H22INO3 — CID 135373931
[1-(2-iodophenyl)-1-methoxybutyl]-propan-2-ylcarbamic acid (PubChem CID 135373931) has the molecular formula C15H22INO3 and a molecular weight of 391.25 g/mol. Its IUPAC name is [1-(2-iodophenyl)-1-methoxybutyl]-propan-2-ylcarbamic acid.
| Compound Name | [1-(2-iodophenyl)-1-methoxybutyl]-propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 135373931 |
| Molecular Formula | C15H22INO3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [1-(2-iodophenyl)-1-methoxybutyl]-propan-2-ylcarbamic acid |
| SMILES | CCCC(OC)(c1ccccc1I)N(C(=O)O)C(C)C |
| InChI | InChI=1S/C15H22INO3/c1-5-10-15(20-4,17(11(2)3)14(18)19)12-8-6-7-9-13(12)16/h6-9,11H,5,10H2,1-4H3,(H,18,19) |
| InChIKey | CLXQWBHYBGSEBY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|