C15H22INO3 — CID 174741142
[4-hydroxy-4-(2-iodophenyl)-6-methylheptan-2-yl] carbamate (PubChem CID 174741142) has the molecular formula C15H22INO3 and a molecular weight of 391.25 g/mol. Its IUPAC name is [4-hydroxy-4-(2-iodophenyl)-6-methylheptan-2-yl] carbamate.
| Compound Name | [4-hydroxy-4-(2-iodophenyl)-6-methylheptan-2-yl] carbamate |
|---|---|
| PubChem CID | 174741142 |
| Molecular Formula | C15H22INO3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [4-hydroxy-4-(2-iodophenyl)-6-methylheptan-2-yl] carbamate |
| SMILES | CC(C)CC(O)(CC(C)OC(N)=O)c1ccccc1I |
| InChI | InChI=1S/C15H22INO3/c1-10(2)8-15(19,9-11(3)20-14(17)18)12-6-4-5-7-13(12)16/h4-7,10-11,19H,8-9H2,1-3H3,(H2,17,18) |
| InChIKey | XTXPQEIVRKGWRJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|