C13H19IO — CID 11974474
3-(2-iodophenyl)-2,4-dimethylpentan-3-ol (PubChem CID 11974474) has the molecular formula C13H19IO and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-(2-iodophenyl)-2,4-dimethylpentan-3-ol.
| Compound Name | 3-(2-iodophenyl)-2,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 11974474 |
| Molecular Formula | C13H19IO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-(2-iodophenyl)-2,4-dimethylpentan-3-ol |
| SMILES | CC(C)C(O)(c1ccccc1I)C(C)C |
| InChI | InChI=1S/C13H19IO/c1-9(2)13(15,10(3)4)11-7-5-6-8-12(11)14/h5-10,15H,1-4H3 |
| InChIKey | ZKPLDEWXRKWXTD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|