C14H20INO3 — CID 174741050
[(3S)-3-hydroxy-3-(2-iodophenyl)-2-methylhexan-2-yl] carbamate (PubChem CID 174741050) has the molecular formula C14H20INO3 and a molecular weight of 377.22 g/mol. Its IUPAC name is [(3S)-3-hydroxy-3-(2-iodophenyl)-2-methylhexan-2-yl] carbamate.
| Compound Name | [(3S)-3-hydroxy-3-(2-iodophenyl)-2-methylhexan-2-yl] carbamate |
|---|---|
| PubChem CID | 174741050 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | [(3S)-3-hydroxy-3-(2-iodophenyl)-2-methylhexan-2-yl] carbamate |
| SMILES | CCC[C@](O)(c1ccccc1I)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C14H20INO3/c1-4-9-14(18,13(2,3)19-12(16)17)10-7-5-6-8-11(10)15/h5-8,18H,4,9H2,1-3H3,(H2,16,17)/t14-/m0/s1 |
| InChIKey | XWBJSNDJIDEXHZ-AWEZNQCLSA-N |
| XLogP | 3.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|