C18H26INO4 — CID 174774205
[(2S)-2-[(1S)-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]cyclopropyl] carbamate (PubChem CID 174774205) has the molecular formula C18H26INO4 and a molecular weight of 447.31 g/mol. Its IUPAC name is [(2S)-2-[(1S)-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]cyclopropyl] carbamate.
| Compound Name | [(2S)-2-[(1S)-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]cyclopropyl] carbamate |
|---|---|
| PubChem CID | 174774205 |
| Molecular Formula | C18H26INO4 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [(2S)-2-[(1S)-1-(2-iodophenyl)-1-(methoxymethoxy)hexyl]cyclopropyl] carbamate |
| SMILES | CCCCC[C@@](OCOC)(c1ccccc1I)[C@H]1CC1OC(N)=O |
| InChI | InChI=1S/C18H26INO4/c1-3-4-7-10-18(23-12-22-2,13-8-5-6-9-15(13)19)14-11-16(14)24-17(20)21/h5-6,8-9,14,16H,3-4,7,10-12H2,1-2H3,(H2,20,21)/t14-,16?,18+/m0/s1 |
| InChIKey | UNPYZXGWSZLYCE-GVVCSIHDSA-N |
| XLogP | 4.17 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|