C14H21NO3 — CID 70560200
2-phenoxyheptan-2-yl carbamate (PubChem CID 70560200) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-phenoxyheptan-2-yl carbamate.
| Compound Name | 2-phenoxyheptan-2-yl carbamate |
|---|---|
| PubChem CID | 70560200 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-phenoxyheptan-2-yl carbamate |
| SMILES | CCCCCC(C)(OC(N)=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-3-4-8-11-14(2,18-13(15)16)17-12-9-6-5-7-10-12/h5-7,9-10H,3-4,8,11H2,1-2H3,(H2,15,16) |
| InChIKey | NZVDGOGKUKVXBL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|