C34H38O6S — CID 175210947
[5-(4,4-diphenoxypentylsulfonyl)-2-phenoxypentan-2-yl]oxybenzene (PubChem CID 175210947) has the molecular formula C34H38O6S and a molecular weight of 574.74 g/mol. Its IUPAC name is [5-(4,4-diphenoxypentylsulfonyl)-2-phenoxypentan-2-yl]oxybenzene.
| Compound Name | [5-(4,4-diphenoxypentylsulfonyl)-2-phenoxypentan-2-yl]oxybenzene |
|---|---|
| PubChem CID | 175210947 |
| Molecular Formula | C34H38O6S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | [5-(4,4-diphenoxypentylsulfonyl)-2-phenoxypentan-2-yl]oxybenzene |
| SMILES | CC(CCCS(=O)(=O)CCCC(C)(Oc1ccccc1)Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C34H38O6S/c1-33(37-29-17-7-3-8-18-29,38-30-19-9-4-10-20-30)25-15-27-41(35,36)28-16-26-34(2,39-31-21-11-5-12-22-31)40-32-23-13-6-14-24-32/h3-14,17-24H,15-16,25-28H2,1-2H3 |
| InChIKey | GXJWQPPUJJFEFN-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|