C15H23IO2Si — CID 139606604
2-ethyl-2-(2-iodophenyl)-4-trimethylsilylbutanoic acid (PubChem CID 139606604) has the molecular formula C15H23IO2Si and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-ethyl-2-(2-iodophenyl)-4-trimethylsilylbutanoic acid.
| Compound Name | 2-ethyl-2-(2-iodophenyl)-4-trimethylsilylbutanoic acid |
|---|---|
| PubChem CID | 139606604 |
| Molecular Formula | C15H23IO2Si |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-ethyl-2-(2-iodophenyl)-4-trimethylsilylbutanoic acid |
| SMILES | CCC(CC[Si](C)(C)C)(C(=O)O)c1ccccc1I |
| InChI | InChI=1S/C15H23IO2Si/c1-5-15(14(17)18,10-11-19(2,3)4)12-8-6-7-9-13(12)16/h6-9H,5,10-11H2,1-4H3,(H,17,18) |
| InChIKey | XJQDIFGQURZWDQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|