About (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate
(2-chloro-6-iodophenyl) N-propan-2-ylcarbamate (PubChem CID 11209985) has the molecular formula C10H11ClINO2
and a molecular weight of 339.56 g/mol. Its IUPAC name is (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate |
| PubChem CID | 11209985 |
| Molecular Formula | C10H11ClINO2 |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1c(Cl)cccc1I |
| InChI | InChI=1S/C10H11ClINO2/c1-6(2)13-10(14)15-9-7(11)4-3-5-8(9)12/h3-6H,1-2H3,(H,13,14) |
| InChIKey | KXUXKPWFCOGCKK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate?
The IUPAC name of (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate (CID 11209985) is (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate.
What is the SMILES notation for (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate?
The canonical SMILES for (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1c(Cl)cccc1I.
What is the InChIKey of (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate?
The InChIKey is KXUXKPWFCOGCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClINO2/c1-6(2)13-10(14)15-9-7(11)4-3-5-8(9)12/h3-6H,1-2H3,(H,13,14).
What are the key properties of (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate?
(2-chloro-6-iodophenyl) N-propan-2-ylcarbamate has a molecular weight of 339.56 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-6-iodophenyl) N-propan-2-ylcarbamate is sourced from PubChem (CID 11209985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).