C22H38ClNO2Sn — CID 15537285
(2-chloro-6-tributylstannylphenyl) N-propan-2-ylcarbamate (PubChem CID 15537285) has the molecular formula C22H38ClNO2Sn and a molecular weight of 502.72 g/mol. Its IUPAC name is (2-chloro-6-tributylstannylphenyl) N-propan-2-ylcarbamate.
| Compound Name | (2-chloro-6-tributylstannylphenyl) N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 15537285 |
| Molecular Formula | C22H38ClNO2Sn |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (2-chloro-6-tributylstannylphenyl) N-propan-2-ylcarbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(Cl)c1OC(=O)NC(C)C |
| InChI | InChI=1S/C10H11ClNO2.3C4H9.Sn/c1-7(2)12-10(13)14-9-6-4-3-5-8(9)11;3*1-3-4-2;/h3-5,7H,1-2H3,(H,12,13);3*1,3-4H2,2H3; |
| InChIKey | DGHCTIRXEIHHQU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |