C15H18Cl2O4 — CID 91708556
1-O-butyl 3-O-(2,6-dichlorophenyl) 2,2-dimethylpropanedioate (PubChem CID 91708556) has the molecular formula C15H18Cl2O4 and a molecular weight of 333.21 g/mol. Its IUPAC name is 1-O-butyl 3-O-(2,6-dichlorophenyl) 2,2-dimethylpropanedioate.
| Compound Name | 1-O-butyl 3-O-(2,6-dichlorophenyl) 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 91708556 |
| Molecular Formula | C15H18Cl2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-O-butyl 3-O-(2,6-dichlorophenyl) 2,2-dimethylpropanedioate |
| SMILES | CCCCOC(=O)C(C)(C)C(=O)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H18Cl2O4/c1-4-5-9-20-13(18)15(2,3)14(19)21-12-10(16)7-6-8-11(12)17/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | XQUSAFRUHCYKBW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|