C17H21Cl3O4 — CID 91691676
1-O-(4-methylpentyl) 3-O-(2,4,6-trichlorophenyl) 2,2-dimethylpropanedioate (PubChem CID 91691676) has the molecular formula C17H21Cl3O4 and a molecular weight of 395.71 g/mol. Its IUPAC name is 1-O-(4-methylpentyl) 3-O-(2,4,6-trichlorophenyl) 2,2-dimethylpropanedioate.
| Compound Name | 1-O-(4-methylpentyl) 3-O-(2,4,6-trichlorophenyl) 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 91691676 |
| Molecular Formula | C17H21Cl3O4 |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-O-(4-methylpentyl) 3-O-(2,4,6-trichlorophenyl) 2,2-dimethylpropanedioate |
| SMILES | CC(C)CCCOC(=O)C(C)(C)C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl3O4/c1-10(2)6-5-7-23-15(21)17(3,4)16(22)24-14-12(19)8-11(18)9-13(14)20/h8-10H,5-7H2,1-4H3 |
| InChIKey | NESQWCKSIZSKSL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|