C13H15Cl2NO2 — CID 134113156
(2,6-dichlorophenyl) N-cyclohexylcarbamate (PubChem CID 134113156) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl) N-cyclohexylcarbamate.
| Compound Name | (2,6-dichlorophenyl) N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 134113156 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (2,6-dichlorophenyl) N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)Oc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO2/c14-10-7-4-8-11(15)12(10)18-13(17)16-9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H,16,17) |
| InChIKey | DOMYEKHPLGTSDD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |