C19H20Cl2N2O2 — CID 58211063
N-cyclohexyl-6-[(2,6-dichlorophenoxy)methyl]pyridine-2-carboxamide (PubChem CID 58211063) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-cyclohexyl-6-[(2,6-dichlorophenoxy)methyl]pyridine-2-carboxamide.
| Compound Name | N-cyclohexyl-6-[(2,6-dichlorophenoxy)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58211063 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-cyclohexyl-6-[(2,6-dichlorophenoxy)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(COc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-15-9-5-10-16(21)18(15)25-12-14-8-4-11-17(22-14)19(24)23-13-6-2-1-3-7-13/h4-5,8-11,13H,1-3,6-7,12H2,(H,23,24) |
| InChIKey | PCGVOTAUDCJNQA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |