C17H19Cl2N3O2 — CID 4867173
N-cyclohexyl-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 4867173) has the molecular formula C17H19Cl2N3O2 and a molecular weight of 368.26 g/mol. Its IUPAC name is N-cyclohexyl-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-cyclohexyl-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4867173 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-cyclohexyl-1-[(2,6-dichlorophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccn(COc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C17H19Cl2N3O2/c18-13-7-4-8-14(19)16(13)24-11-22-10-9-15(21-22)17(23)20-12-5-2-1-3-6-12/h4,7-10,12H,1-3,5-6,11H2,(H,20,23) |
| InChIKey | TULKMTONLNDDOK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |