C23H17Cl2N3O2 — CID 19269906
1-[(2,6-dichlorophenoxy)methyl]-N-(4-phenylphenyl)pyrazole-3-carboxamide (PubChem CID 19269906) has the molecular formula C23H17Cl2N3O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenoxy)methyl]-N-(4-phenylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(4-phenylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19269906 |
| Molecular Formula | C23H17Cl2N3O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-[(2,6-dichlorophenoxy)methyl]-N-(4-phenylphenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)c1ccn(COc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C23H17Cl2N3O2/c24-19-7-4-8-20(25)22(19)30-15-28-14-13-21(27-28)23(29)26-18-11-9-17(10-12-18)16-5-2-1-3-6-16/h1-14H,15H2,(H,26,29) |
| InChIKey | YIOIKGLMNDOEDC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |