C28H38N2O6 — CID 19886806
[4-(cyclohexylcarbamoyloxy)-2,3-diethoxynaphthalen-1-yl] N-cyclohexylcarbamate (PubChem CID 19886806) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is [4-(cyclohexylcarbamoyloxy)-2,3-diethoxynaphthalen-1-yl] N-cyclohexylcarbamate.
| Compound Name | [4-(cyclohexylcarbamoyloxy)-2,3-diethoxynaphthalen-1-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 19886806 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | [4-(cyclohexylcarbamoyloxy)-2,3-diethoxynaphthalen-1-yl] N-cyclohexylcarbamate |
| SMILES | CCOc1c(OCC)c(OC(=O)NC2CCCCC2)c2ccccc2c1OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H38N2O6/c1-3-33-25-23(35-27(31)29-19-13-7-5-8-14-19)21-17-11-12-18-22(21)24(26(25)34-4-2)36-28(32)30-20-15-9-6-10-16-20/h11-12,17-20H,3-10,13-16H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | IPHBPGQVDGIZJH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |