C28H36O8 — CID 19886830
cyclohexyl (4-cyclohexyloxycarbonyloxy-2,3-diethoxynaphthalen-1-yl) carbonate (PubChem CID 19886830) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is cyclohexyl (4-cyclohexyloxycarbonyloxy-2,3-diethoxynaphthalen-1-yl) carbonate.
| Compound Name | cyclohexyl (4-cyclohexyloxycarbonyloxy-2,3-diethoxynaphthalen-1-yl) carbonate |
|---|---|
| PubChem CID | 19886830 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | cyclohexyl (4-cyclohexyloxycarbonyloxy-2,3-diethoxynaphthalen-1-yl) carbonate |
| SMILES | CCOc1c(OCC)c(OC(=O)OC2CCCCC2)c2ccccc2c1OC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C28H36O8/c1-3-31-25-23(35-27(29)33-19-13-7-5-8-14-19)21-17-11-12-18-22(21)24(26(25)32-4-2)36-28(30)34-20-15-9-6-10-16-20/h11-12,17-20H,3-10,13-16H2,1-2H3 |
| InChIKey | GRGWZFFILJQMTE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|