C22H20O4S — CID 56607814
cyclopentyl (4-hydroxy-2,5-diphenylthiophen-3-yl) carbonate (PubChem CID 56607814) has the molecular formula C22H20O4S and a molecular weight of 380.46 g/mol. Its IUPAC name is cyclopentyl (4-hydroxy-2,5-diphenylthiophen-3-yl) carbonate.
| Compound Name | cyclopentyl (4-hydroxy-2,5-diphenylthiophen-3-yl) carbonate |
|---|---|
| PubChem CID | 56607814 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | cyclopentyl (4-hydroxy-2,5-diphenylthiophen-3-yl) carbonate |
| SMILES | O=C(Oc1c(-c2ccccc2)sc(-c2ccccc2)c1O)OC1CCCC1 |
| InChI | InChI=1S/C22H20O4S/c23-18-19(26-22(24)25-17-13-7-8-14-17)21(16-11-5-2-6-12-16)27-20(18)15-9-3-1-4-10-15/h1-6,9-12,17,23H,7-8,13-14H2 |
| InChIKey | RAGVELZMLIULFI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|