C14H25NO5 — CID 175294543
[4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate (PubChem CID 175294543) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is [4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate.
| Compound Name | [4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate |
|---|---|
| PubChem CID | 175294543 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] propanoate |
| SMILES | CCC(=O)OC1CCC(O)C(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H25NO5/c1-5-12(17)19-9-6-7-11(16)10(8-9)15-13(18)20-14(2,3)4/h9-11,16H,5-8H2,1-4H3,(H,15,18) |
| InChIKey | JRTVZZMVPDGAGS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |