C10H8N4O2 — CID 175295238
1,2,4-triazol-1-yl 3-pyridin-3-ylprop-2-enoate (PubChem CID 175295238) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 1,2,4-triazol-1-yl 3-pyridin-3-ylprop-2-enoate.
| Compound Name | 1,2,4-triazol-1-yl 3-pyridin-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 175295238 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1,2,4-triazol-1-yl 3-pyridin-3-ylprop-2-enoate |
| SMILES | O=C(C=Cc1cccnc1)On1cncn1 |
| InChI | InChI=1S/C10H8N4O2/c15-10(16-14-8-12-7-13-14)4-3-9-2-1-5-11-6-9/h1-8H |
| InChIKey | CTDDHIYKHSQWSS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|