C18H21NO3 — CID 175296858
[2,2-diethyl-5-(furan-3-yl)-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296858) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [2,2-diethyl-5-(furan-3-yl)-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [2,2-diethyl-5-(furan-3-yl)-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296858 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [2,2-diethyl-5-(furan-3-yl)-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CCC1(CC)Cc2cc(-c3ccoc3)ccc2C1OC(N)=O |
| InChI | InChI=1S/C18H21NO3/c1-3-18(4-2)10-14-9-12(13-7-8-21-11-13)5-6-15(14)16(18)22-17(19)20/h5-9,11,16H,3-4,10H2,1-2H3,(H2,19,20) |
| InChIKey | AARALRAOUXSKRA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |