C23H18Cl4F3N5O3 — CID 175296980
5-chloro-4-(4-chlorophenyl)-1-[[1-(3,4-dichlorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one (PubChem CID 175296980) has the molecular formula C23H18Cl4F3N5O3 and a molecular weight of 611.24 g/mol. Its IUPAC name is 5-chloro-4-(4-chlorophenyl)-1-[[1-(3,4-dichlorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one.
| Compound Name | 5-chloro-4-(4-chlorophenyl)-1-[[1-(3,4-dichlorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one |
|---|---|
| PubChem CID | 175296980 |
| Molecular Formula | C23H18Cl4F3N5O3 |
| Molecular Weight | 611.24 g/mol |
| Exact Mass | 609.01 |
| IUPAC Name | 5-chloro-4-(4-chlorophenyl)-1-[[1-(3,4-dichlorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one |
| SMILES | CC(O)c1nc(Cn2c(Cl)c(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl4F3N5O3/c1-11(36)21-31-18(32-35(21)14-6-7-15(25)16(26)8-14)10-34-20(27)19(12-2-4-13(24)5-3-12)33(22(34)38)9-17(37)23(28,29)30/h2-8,11,17,36-37H,9-10H2,1H3 |
| InChIKey | GOFXJKVTHRRJRN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.24 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |