C23H22ClF3N6O3 — CID 121301518
5-(4-chlorophenyl)-2-[[5-(1-hydroxyethyl)-1-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 121301518) has the molecular formula C23H22ClF3N6O3 and a molecular weight of 522.92 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[5-(1-hydroxyethyl)-1-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[5-(1-hydroxyethyl)-1-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 121301518 |
| Molecular Formula | C23H22ClF3N6O3 |
| Molecular Weight | 522.92 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[5-(1-hydroxyethyl)-1-(3-methylphenyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | Cc1cccc(-n2nc(Cn3nc(-c4ccc(Cl)cc4)n(C[C@H](O)C(F)(F)F)c3=O)nc2C(C)O)c1 |
| InChI | InChI=1S/C23H22ClF3N6O3/c1-13-4-3-5-17(10-13)33-20(14(2)34)28-19(29-33)12-32-22(36)31(11-18(35)23(25,26)27)21(30-32)15-6-8-16(24)9-7-15/h3-10,14,18,34-35H,11-12H2,1-2H3/t14?,18-/m0/s1 |
| InChIKey | KGRZMUFPGFQNNU-IBYPIGCZSA-N |
| XLogP | 3.28 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.92 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |