C16H17AlClF3N6O3 — CID 147651382
2-[[1-alumanyl-5-[(1R)-1-hydroxyethyl]-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 147651382) has the molecular formula C16H17AlClF3N6O3 and a molecular weight of 460.78 g/mol. Its IUPAC name is 2-[[1-alumanyl-5-[(1R)-1-hydroxyethyl]-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[[1-alumanyl-5-[(1R)-1-hydroxyethyl]-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 147651382 |
| Molecular Formula | C16H17AlClF3N6O3 |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-[[1-alumanyl-5-[(1R)-1-hydroxyethyl]-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | C[C@@H](O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1[AlH2] |
| InChI | InChI=1S/C16H15ClF3N6O3.Al.2H/c1-8(27)13-21-12(22-23-13)7-26-15(29)25(6-11(28)16(18,19)20)14(24-26)9-2-4-10(17)5-3-9;;;/h2-5,8,11,27-28H,6-7H2,1H3;;;/q-1;+1;;/t8-,11+;;;/m1.../s1 |
| InChIKey | GJOJPOGRWKXUQK-BUMNEDFOSA-N |
| XLogP | 0.38 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |