C16H15ClF3N7O3 — CID 146479326
2-[[1-amino-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-oxopropyl)-1,2,4-triazol-3-one (PubChem CID 146479326) has the molecular formula C16H15ClF3N7O3 and a molecular weight of 445.79 g/mol. Its IUPAC name is 2-[[1-amino-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-oxopropyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[[1-amino-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-oxopropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 146479326 |
| Molecular Formula | C16H15ClF3N7O3 |
| Molecular Weight | 445.79 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[[1-amino-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-oxopropyl)-1,2,4-triazol-3-one |
| SMILES | CC(O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(CC(=O)C(F)(F)F)c2=O)nn1N |
| InChI | InChI=1S/C16H15ClF3N7O3/c1-8(28)13-22-12(23-27(13)21)7-26-15(30)25(6-11(29)16(18,19)20)14(24-26)9-2-4-10(17)5-3-9/h2-5,8,28H,6-7,21H2,1H3 |
| InChIKey | CBIMPXQCZUCUQZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.79 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |