C21H19Cl2F3N8O2 — CID 155071336
2-[[5-(1-aminoethyl)-1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one (PubChem CID 155071336) has the molecular formula C21H19Cl2F3N8O2 and a molecular weight of 543.34 g/mol. Its IUPAC name is 2-[[5-(1-aminoethyl)-1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[[5-(1-aminoethyl)-1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155071336 |
| Molecular Formula | C21H19Cl2F3N8O2 |
| Molecular Weight | 543.34 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 2-[[5-(1-aminoethyl)-1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
| SMILES | CC(N)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C21H19Cl2F3N8O2/c1-11(27)17-29-16(30-34(17)19-14(23)3-2-8-28-19)10-33-20(36)32(9-15(35)21(24,25)26)18(31-33)12-4-6-13(22)7-5-12/h2-8,11,15,35H,9-10,27H2,1H3 |
| InChIKey | REFZFZDNVBFIMY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |