C22H20ClF4N7O2 — CID 142564138
2-[[5-(1-aminoethyl)-1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 142564138) has the molecular formula C22H20ClF4N7O2 and a molecular weight of 525.89 g/mol. Its IUPAC name is 2-[[5-(1-aminoethyl)-1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[[5-(1-aminoethyl)-1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 142564138 |
| Molecular Formula | C22H20ClF4N7O2 |
| Molecular Weight | 525.89 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-[[5-(1-aminoethyl)-1-(3-fluorophenyl)-1,2,4-triazol-3-yl]methyl]-5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | CC(N)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H20ClF4N7O2/c1-12(28)19-29-18(30-34(19)16-4-2-3-15(24)9-16)11-33-21(36)32(10-17(35)22(25,26)27)20(31-33)13-5-7-14(23)8-6-13/h2-9,12,17,35H,10-11,28H2,1H3/t12?,17-/m0/s1 |
| InChIKey | LXQMQWSPPDRHOL-TYJDENFWSA-N |
| XLogP | 3.08 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |