C25H22Cl2F3N7O4 — CID 142564304
5-(4-chlorophenyl)-2-[[1-(3-chlorophenyl)-5-(morpholine-4-carbonyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 142564304) has the molecular formula C25H22Cl2F3N7O4 and a molecular weight of 612.40 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(3-chlorophenyl)-5-(morpholine-4-carbonyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(3-chlorophenyl)-5-(morpholine-4-carbonyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 142564304 |
| Molecular Formula | C25H22Cl2F3N7O4 |
| Molecular Weight | 612.40 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(3-chlorophenyl)-5-(morpholine-4-carbonyl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | O=C(c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1-c1cccc(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C25H22Cl2F3N7O4/c26-16-6-4-15(5-7-16)21-33-36(24(40)35(21)13-19(38)25(28,29)30)14-20-31-22(23(39)34-8-10-41-11-9-34)37(32-20)18-3-1-2-17(27)12-18/h1-7,12,19,38H,8-11,13-14H2/t19-/m0/s1 |
| InChIKey | BDWSKCDRKRPKRX-IBGZPJMESA-N |
| XLogP | 3.04 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |