C15H14AlClF3N7O3 — CID 147885257
2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 147885257) has the molecular formula C15H14AlClF3N7O3 and a molecular weight of 459.75 g/mol. Its IUPAC name is 2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 147885257 |
| Molecular Formula | C15H14AlClF3N7O3 |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1[AlH2] |
| InChI | InChI=1S/C15H13ClF3N7O3.Al.2H/c16-8-3-1-7(2-4-8)13-24-26(6-10-21-12(11(20)28)23-22-10)14(29)25(13)5-9(27)15(17,18)19;;;/h1-4,9,27H,5-6H2,(H3,20,21,22,23,28);;;/q;+1;;/p-1/t9-;;;/m0.../s1 |
| InChIKey | IBFCODSTVQTBFX-DXYFNVQQSA-M |
| XLogP | -0.58 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |