C17H18AlClF3N7O4 — CID 147803004
2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-N-methoxy-N-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 147803004) has the molecular formula C17H18AlClF3N7O4 and a molecular weight of 503.81 g/mol. Its IUPAC name is 2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-N-methoxy-N-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-N-methoxy-N-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 147803004 |
| Molecular Formula | C17H18AlClF3N7O4 |
| Molecular Weight | 503.81 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-alumanyl-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-N-methoxy-N-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | CON(C)C(=O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1[AlH2] |
| InChI | InChI=1S/C17H17ClF3N7O4.Al.2H/c1-26(32-2)15(30)13-22-12(23-24-13)8-28-16(31)27(7-11(29)17(19,20)21)14(25-28)9-3-5-10(18)6-4-9;;;/h3-6,11,29H,7-8H2,1-2H3,(H,22,23,24,30);;;/q;+1;;/p-1 |
| InChIKey | HLWNZLBJCOOMBE-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.81 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|