C22H18Cl2F3N7O4 — CID 138558998
methyl 2-(2-chloro-4-methyl-3-pyridinyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxylate (PubChem CID 138558998) has the molecular formula C22H18Cl2F3N7O4 and a molecular weight of 572.33 g/mol. Its IUPAC name is methyl 2-(2-chloro-4-methyl-3-pyridinyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 2-(2-chloro-4-methyl-3-pyridinyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 138558998 |
| Molecular Formula | C22H18Cl2F3N7O4 |
| Molecular Weight | 572.33 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | methyl 2-(2-chloro-4-methyl-3-pyridinyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1-c1c(C)ccnc1Cl |
| InChI | InChI=1S/C22H18Cl2F3N7O4/c1-11-7-8-28-17(24)16(11)34-19(20(36)38-2)29-15(30-34)10-33-21(37)32(9-14(35)22(25,26)27)18(31-33)12-3-5-13(23)6-4-12/h3-8,14,35H,9-10H2,1-2H3 |
| InChIKey | VQBDBRSFJMALGX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|