C23H20Cl2F3N7O4 — CID 138611295
1-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(5-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl acetate (PubChem CID 138611295) has the molecular formula C23H20Cl2F3N7O4 and a molecular weight of 586.36 g/mol. Its IUPAC name is 1-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(5-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl acetate.
| Compound Name | 1-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(5-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 138611295 |
| Molecular Formula | C23H20Cl2F3N7O4 |
| Molecular Weight | 586.36 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | 1-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-2-(5-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1-c1ccc(Cl)cn1 |
| InChI | InChI=1S/C23H20Cl2F3N7O4/c1-12(39-13(2)36)20-30-18(31-35(20)19-8-7-16(25)9-29-19)11-34-22(38)33(10-17(37)23(26,27)28)21(32-34)14-3-5-15(24)6-4-14/h3-9,12,17,37H,10-11H2,1-2H3 |
| InChIKey | UBCVFBNYSCXADP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |