C24H23Cl2F3N6O3 — CID 139579577
5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(1-hydroxy-2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one (PubChem CID 139579577) has the molecular formula C24H23Cl2F3N6O3 and a molecular weight of 571.39 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(1-hydroxy-2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(1-hydroxy-2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 139579577 |
| Molecular Formula | C24H23Cl2F3N6O3 |
| Molecular Weight | 571.39 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(1-hydroxy-2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
| SMILES | CC(C)C(O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C24H23Cl2F3N6O3/c1-13(2)20(37)22-30-19(31-35(22)17-6-4-3-5-16(17)26)12-34-23(38)33(11-18(36)24(27,28)29)21(32-34)14-7-9-15(25)10-8-14/h3-10,13,18,20,36-37H,11-12H2,1-2H3 |
| InChIKey | DNJHGPMLUAVQMC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |