C25H24Cl2F3N7O3 — CID 155045423
5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(3-methoxypyrrolidin-1-yl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one (PubChem CID 155045423) has the molecular formula C25H24Cl2F3N7O3 and a molecular weight of 598.41 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(3-methoxypyrrolidin-1-yl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(3-methoxypyrrolidin-1-yl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155045423 |
| Molecular Formula | C25H24Cl2F3N7O3 |
| Molecular Weight | 598.41 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(3-methoxypyrrolidin-1-yl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
| SMILES | COC1CCN(c2nc(Cn3nc(-c4ccc(Cl)cc4)n(CC(O)C(F)(F)F)c3=O)nn2-c2ccccc2Cl)C1 |
| InChI | InChI=1S/C25H24Cl2F3N7O3/c1-40-17-10-11-34(12-17)23-31-21(32-37(23)19-5-3-2-4-18(19)27)14-36-24(39)35(13-20(38)25(28,29)30)22(33-36)15-6-8-16(26)9-7-15/h2-9,17,20,38H,10-14H2,1H3 |
| InChIKey | KXYPZSKKRFWRDZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |