C25H26Cl2F3N7O2 — CID 142564014
5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylpropylamino)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 142564014) has the molecular formula C25H26Cl2F3N7O2 and a molecular weight of 584.43 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylpropylamino)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylpropylamino)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 142564014 |
| Molecular Formula | C25H26Cl2F3N7O2 |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylpropylamino)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | CC(C)(C)CNc1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C25H26Cl2F3N7O2/c1-24(2,3)14-31-22-32-20(33-37(22)18-7-5-4-6-17(18)27)13-36-23(39)35(12-19(38)25(28,29)30)21(34-36)15-8-10-16(26)11-9-15/h4-11,19,38H,12-14H2,1-3H3,(H,31,32,33)/t19-/m0/s1 |
| InChIKey | DFGXRXNOHBIYHC-IBGZPJMESA-N |
| XLogP | 5.03 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |