C27H29Cl2F3N8O3 — CID 155052720
5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-[(4-hydroxyazepan-4-yl)methylamino]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 155052720) has the molecular formula C27H29Cl2F3N8O3 and a molecular weight of 641.48 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-[(4-hydroxyazepan-4-yl)methylamino]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-[(4-hydroxyazepan-4-yl)methylamino]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155052720 |
| Molecular Formula | C27H29Cl2F3N8O3 |
| Molecular Weight | 641.48 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-[(4-hydroxyazepan-4-yl)methylamino]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(NCC3(O)CCCNCC3)n(-c3ccccc3Cl)n2)nc(-c2ccc(Cl)cc2)n1C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C27H29Cl2F3N8O3/c28-18-8-6-17(7-9-18)23-37-39(25(42)38(23)14-21(41)27(30,31)32)15-22-35-24(34-16-26(43)10-3-12-33-13-11-26)40(36-22)20-5-2-1-4-19(20)29/h1-2,4-9,21,33,41,43H,3,10-16H2,(H,34,35,36)/t21-,26?/m0/s1 |
| InChIKey | APNRXGXKCCKDQX-GVNKFJBHSA-N |
| XLogP | 3.49 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |