C26H26Cl2F3N7O3 — CID 142564062
5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylmorpholin-4-yl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 142564062) has the molecular formula C26H26Cl2F3N7O3 and a molecular weight of 612.44 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylmorpholin-4-yl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylmorpholin-4-yl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 142564062 |
| Molecular Formula | C26H26Cl2F3N7O3 |
| Molecular Weight | 612.44 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(2-chlorophenyl)-5-(2,2-dimethylmorpholin-4-yl)-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | CC1(C)CN(c2nc(Cn3nc(-c4ccc(Cl)cc4)n(C[C@H](O)C(F)(F)F)c3=O)nn2-c2ccccc2Cl)CCO1 |
| InChI | InChI=1S/C26H26Cl2F3N7O3/c1-25(2)15-35(11-12-41-25)23-32-21(33-38(23)19-6-4-3-5-18(19)28)14-37-24(40)36(13-20(39)26(29,30)31)22(34-37)16-7-9-17(27)10-8-16/h3-10,20,39H,11-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | JBXKYJGMRTXEFI-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |