C24H22ClF4N7O3 — CID 155045507
5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one (PubChem CID 155045507) has the molecular formula C24H22ClF4N7O3 and a molecular weight of 567.93 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155045507 |
| Molecular Formula | C24H22ClF4N7O3 |
| Molecular Weight | 567.93 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(N3CCOCC3)n(-c3cccc(F)c3)n2)nc(-c2ccc(Cl)cc2)n1CC(O)C(F)(F)F |
| InChI | InChI=1S/C24H22ClF4N7O3/c25-16-6-4-15(5-7-16)21-32-35(23(38)34(21)13-19(37)24(27,28)29)14-20-30-22(33-8-10-39-11-9-33)36(31-20)18-3-1-2-17(26)12-18/h1-7,12,19,37H,8-11,13-14H2 |
| InChIKey | CGQHESCHZFEXMK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.93 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |