C22H18Cl2F3N7O4 — CID 142564121
[2-(3-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]methyl carbamate (PubChem CID 142564121) has the molecular formula C22H18Cl2F3N7O4 and a molecular weight of 572.33 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]methyl carbamate.
| Compound Name | [2-(3-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]methyl carbamate |
|---|---|
| PubChem CID | 142564121 |
| Molecular Formula | C22H18Cl2F3N7O4 |
| Molecular Weight | 572.33 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | [2-(3-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]methyl carbamate |
| SMILES | NC(=O)OCc1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2F3N7O4/c23-13-6-4-12(5-7-13)19-31-33(21(37)32(19)9-16(35)22(25,26)27)10-17-29-18(11-38-20(28)36)34(30-17)15-3-1-2-14(24)8-15/h1-8,16,35H,9-11H2,(H2,28,36)/t16-/m0/s1 |
| InChIKey | AZSOECNAKKQDBJ-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |