C23H19Cl2F3N8O5 — CID 142564173
[5-[[4-[(2S)-2-carbamoyloxy-3,3,3-trifluoropropyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-2-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl carbamate (PubChem CID 142564173) has the molecular formula C23H19Cl2F3N8O5 and a molecular weight of 615.36 g/mol. Its IUPAC name is [5-[[4-[(2S)-2-carbamoyloxy-3,3,3-trifluoropropyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-2-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl carbamate.
| Compound Name | [5-[[4-[(2S)-2-carbamoyloxy-3,3,3-trifluoropropyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-2-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl carbamate |
|---|---|
| PubChem CID | 142564173 |
| Molecular Formula | C23H19Cl2F3N8O5 |
| Molecular Weight | 615.36 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | [5-[[4-[(2S)-2-carbamoyloxy-3,3,3-trifluoropropyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-1-yl]methyl]-2-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl carbamate |
| SMILES | NC(=O)OCc1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](OC(N)=O)C(F)(F)F)c2=O)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19Cl2F3N8O5/c24-13-6-4-12(5-7-13)19-33-35(22(39)34(19)9-16(23(26,27)28)41-21(30)38)10-17-31-18(11-40-20(29)37)36(32-17)15-3-1-2-14(25)8-15/h1-8,16H,9-11H2,(H2,29,37)(H2,30,38)/t16-/m0/s1 |
| InChIKey | LOGYEKTUALERKJ-INIZCTEOSA-N |
| XLogP | 3.27 |
| TPSA | 175.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |