C26H29BrClF3N6O2Si — CID 154621980
2-[(5-bromo-1-phenyl-1,2,4-triazol-3-yl)methyl]-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-1,2,4-triazol-3-one (PubChem CID 154621980) has the molecular formula C26H29BrClF3N6O2Si and a molecular weight of 658.00 g/mol. Its IUPAC name is 2-[(5-bromo-1-phenyl-1,2,4-triazol-3-yl)methyl]-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-1,2,4-triazol-3-one.
| Compound Name | 2-[(5-bromo-1-phenyl-1,2,4-triazol-3-yl)methyl]-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 154621980 |
| Molecular Formula | C26H29BrClF3N6O2Si |
| Molecular Weight | 658.00 g/mol |
| Exact Mass | 656.09 |
| IUPAC Name | 2-[(5-bromo-1-phenyl-1,2,4-triazol-3-yl)methyl]-4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-1,2,4-triazol-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](Cn1c(-c2ccc(Cl)cc2)nn(Cc2nc(Br)n(-c3ccccc3)n2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C26H29BrClF3N6O2Si/c1-25(2,3)40(4,5)39-20(26(29,30)31)15-35-22(17-11-13-18(28)14-12-17)34-36(24(35)38)16-21-32-23(27)37(33-21)19-9-7-6-8-10-19/h6-14,20H,15-16H2,1-5H3/t20-/m0/s1 |
| InChIKey | INHTUUHRANIDCG-FQEVSTJZSA-N |
| XLogP | 6.71 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.00 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|