C23H19ClF6N6O4 — CID 146479201
5-(4-chlorophenyl)-2-[[5-[hydroxy(methoxy)methyl]-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 146479201) has the molecular formula C23H19ClF6N6O4 and a molecular weight of 592.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[5-[hydroxy(methoxy)methyl]-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[5-[hydroxy(methoxy)methyl]-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 146479201 |
| Molecular Formula | C23H19ClF6N6O4 |
| Molecular Weight | 592.88 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[5-[hydroxy(methoxy)methyl]-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | COC(O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H19ClF6N6O4/c1-40-20(38)19-31-17(32-36(19)15-5-3-2-4-14(15)22(25,26)27)11-35-21(39)34(10-16(37)23(28,29)30)18(33-35)12-6-8-13(24)9-7-12/h2-9,16,20,37-38H,10-11H2,1H3/t16-,20?/m0/s1 |
| InChIKey | RWVHWCGQZNUIPL-DJZRFWRSSA-N |
| XLogP | 3.57 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|