C25H29ClF3N7O2Si — CID 150552700
4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-2-[(1-pyridin-2-yl-1,2,4-triazol-3-yl)methyl]-1,2,4-triazol-3-one (PubChem CID 150552700) has the molecular formula C25H29ClF3N7O2Si and a molecular weight of 580.09 g/mol. Its IUPAC name is 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-2-[(1-pyridin-2-yl-1,2,4-triazol-3-yl)methyl]-1,2,4-triazol-3-one.
| Compound Name | 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-2-[(1-pyridin-2-yl-1,2,4-triazol-3-yl)methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 150552700 |
| Molecular Formula | C25H29ClF3N7O2Si |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoropropyl]-5-(4-chlorophenyl)-2-[(1-pyridin-2-yl-1,2,4-triazol-3-yl)methyl]-1,2,4-triazol-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](Cn1c(-c2ccc(Cl)cc2)nn(Cc2ncn(-c3ccccn3)n2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C25H29ClF3N7O2Si/c1-24(2,3)39(4,5)38-19(25(27,28)29)14-34-22(17-9-11-18(26)12-10-17)33-35(23(34)37)15-20-31-16-36(32-20)21-8-6-7-13-30-21/h6-13,16,19H,14-15H2,1-5H3/t19-/m0/s1 |
| InChIKey | IIFBNGSPRVQOKP-IBGZPJMESA-N |
| XLogP | 5.34 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|