C22H18Cl2F4N8O2 — CID 150671118
3-[[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2,4,4,4-tetrafluoro-2-methylbutanamide (PubChem CID 150671118) has the molecular formula C22H18Cl2F4N8O2 and a molecular weight of 573.34 g/mol. Its IUPAC name is 3-[[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2,4,4,4-tetrafluoro-2-methylbutanamide.
| Compound Name | 3-[[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2,4,4,4-tetrafluoro-2-methylbutanamide |
|---|---|
| PubChem CID | 150671118 |
| Molecular Formula | C22H18Cl2F4N8O2 |
| Molecular Weight | 573.34 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | 3-[[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]methyl]-2,4,4,4-tetrafluoro-2-methylbutanamide |
| SMILES | CC(F)(C(N)=O)C(Cn1c(-c2ccc(Cl)cc2)nn(Cc2ncn(-c3ncccc3Cl)n2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C22H18Cl2F4N8O2/c1-21(25,19(29)37)15(22(26,27)28)9-34-17(12-4-6-13(23)7-5-12)33-35(20(34)38)10-16-31-11-36(32-16)18-14(24)3-2-8-30-18/h2-8,11,15H,9-10H2,1H3,(H2,29,37) |
| InChIKey | JFWZZKDGAOVBCJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |