C25H23Cl2F3N8O2 — CID 161184596
N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]cyclopentanecarboxamide (PubChem CID 161184596) has the molecular formula C25H23Cl2F3N8O2 and a molecular weight of 595.41 g/mol. Its IUPAC name is N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]cyclopentanecarboxamide.
| Compound Name | N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 161184596 |
| Molecular Formula | C25H23Cl2F3N8O2 |
| Molecular Weight | 595.41 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]cyclopentanecarboxamide |
| SMILES | O=C(NC(Cn1c(-c2ccc(Cl)cc2)nn(Cc2ncn(-c3ncccc3Cl)n2)c1=O)C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C25H23Cl2F3N8O2/c26-17-9-7-15(8-10-17)21-35-37(13-20-32-14-38(34-20)22-18(27)6-3-11-31-22)24(40)36(21)12-19(25(28,29)30)33-23(39)16-4-1-2-5-16/h3,6-11,14,16,19H,1-2,4-5,12-13H2,(H,33,39) |
| InChIKey | USXMMFWPEAECRP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |